C12H16N4O3S — CID 113011375
5-(dimethylsulfamoylamino)-2-(furan-2-ylmethylamino)pyridine (PubChem CID 113011375) has the molecular formula C12H16N4O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is 5-(dimethylsulfamoylamino)-2-(furan-2-ylmethylamino)pyridine.
| Compound Name | 5-(dimethylsulfamoylamino)-2-(furan-2-ylmethylamino)pyridine |
|---|---|
| PubChem CID | 113011375 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 5-(dimethylsulfamoylamino)-2-(furan-2-ylmethylamino)pyridine |
| SMILES | CN(C)S(=O)(=O)Nc1ccc(NCc2ccco2)nc1 |
| InChI | InChI=1S/C12H16N4O3S/c1-16(2)20(17,18)15-10-5-6-12(13-8-10)14-9-11-4-3-7-19-11/h3-8,15H,9H2,1-2H3,(H,13,14) |
| InChIKey | QLWVJVGMIKRQMQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |