C15H18N4O4S — CID 113012557
2-(1,3-benzodioxol-5-ylmethylamino)-5-(dimethylsulfamoylamino)pyridine (PubChem CID 113012557) has the molecular formula C15H18N4O4S and a molecular weight of 350.40 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethylamino)-5-(dimethylsulfamoylamino)pyridine.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethylamino)-5-(dimethylsulfamoylamino)pyridine |
|---|---|
| PubChem CID | 113012557 |
| Molecular Formula | C15H18N4O4S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethylamino)-5-(dimethylsulfamoylamino)pyridine |
| SMILES | CN(C)S(=O)(=O)Nc1ccc(NCc2ccc3c(c2)OCO3)nc1 |
| InChI | InChI=1S/C15H18N4O4S/c1-19(2)24(20,21)18-12-4-6-15(17-9-12)16-8-11-3-5-13-14(7-11)23-10-22-13/h3-7,9,18H,8,10H2,1-2H3,(H,16,17) |
| InChIKey | QHDJPMCVZDWITR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |