C17H20N4O3 — CID 82034218
4-amino-N-[5-(1,3-benzodioxol-5-ylmethylamino)-2-pyridinyl]butanamide (PubChem CID 82034218) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 4-amino-N-[5-(1,3-benzodioxol-5-ylmethylamino)-2-pyridinyl]butanamide.
| Compound Name | 4-amino-N-[5-(1,3-benzodioxol-5-ylmethylamino)-2-pyridinyl]butanamide |
|---|---|
| PubChem CID | 82034218 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 4-amino-N-[5-(1,3-benzodioxol-5-ylmethylamino)-2-pyridinyl]butanamide |
| SMILES | NCCCC(=O)Nc1ccc(NCc2ccc3c(c2)OCO3)cn1 |
| InChI | InChI=1S/C17H20N4O3/c18-7-1-2-17(22)21-16-6-4-13(10-20-16)19-9-12-3-5-14-15(8-12)24-11-23-14/h3-6,8,10,19H,1-2,7,9,11,18H2,(H,20,21,22) |
| InChIKey | GMRWGPZFUOLVKC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |