C20H25N3O3 — CID 109190646
5-(1,3-benzodioxol-5-ylmethylamino)-N,N-dipropylpyridine-2-carboxamide (PubChem CID 109190646) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethylamino)-N,N-dipropylpyridine-2-carboxamide.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethylamino)-N,N-dipropylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 109190646 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethylamino)-N,N-dipropylpyridine-2-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(NCc2ccc3c(c2)OCO3)cn1 |
| InChI | InChI=1S/C20H25N3O3/c1-3-9-23(10-4-2)20(24)17-7-6-16(13-22-17)21-12-15-5-8-18-19(11-15)26-14-25-18/h5-8,11,13,21H,3-4,9-10,12,14H2,1-2H3 |
| InChIKey | FSFRWHZLWUKTSE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |