C18H21N3O4S — CID 18133007
6-(1,3-benzodioxol-5-ylmethylamino)-N-cyclopentylpyridine-3-sulfonamide (PubChem CID 18133007) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-ylmethylamino)-N-cyclopentylpyridine-3-sulfonamide.
| Compound Name | 6-(1,3-benzodioxol-5-ylmethylamino)-N-cyclopentylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 18133007 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 6-(1,3-benzodioxol-5-ylmethylamino)-N-cyclopentylpyridine-3-sulfonamide |
| SMILES | O=S(=O)(NC1CCCC1)c1ccc(NCc2ccc3c(c2)OCO3)nc1 |
| InChI | InChI=1S/C18H21N3O4S/c22-26(23,21-14-3-1-2-4-14)15-6-8-18(20-11-15)19-10-13-5-7-16-17(9-13)25-12-24-16/h5-9,11,14,21H,1-4,10,12H2,(H,19,20) |
| InChIKey | KQVMGXSMYCJKIB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |