C16H14FN3O3S — CID 113026312
4-fluoro-N-[5-(furan-2-ylmethylamino)-2-pyridinyl]benzenesulfonamide (PubChem CID 113026312) has the molecular formula C16H14FN3O3S and a molecular weight of 347.37 g/mol. Its IUPAC name is 4-fluoro-N-[5-(furan-2-ylmethylamino)-2-pyridinyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[5-(furan-2-ylmethylamino)-2-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113026312 |
| Molecular Formula | C16H14FN3O3S |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 4-fluoro-N-[5-(furan-2-ylmethylamino)-2-pyridinyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(NCc2ccco2)cn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H14FN3O3S/c17-12-3-6-15(7-4-12)24(21,22)20-16-8-5-13(10-19-16)18-11-14-2-1-9-23-14/h1-10,18H,11H2,(H,19,20) |
| InChIKey | PZYHNSLQBOYDCZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |