C11H22N6O2S — CID 113040165
3-[3-(dimethylamino)propylamino]-6-(dimethylsulfamoylamino)pyridazine (PubChem CID 113040165) has the molecular formula C11H22N6O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 3-[3-(dimethylamino)propylamino]-6-(dimethylsulfamoylamino)pyridazine.
| Compound Name | 3-[3-(dimethylamino)propylamino]-6-(dimethylsulfamoylamino)pyridazine |
|---|---|
| PubChem CID | 113040165 |
| Molecular Formula | C11H22N6O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 3-[3-(dimethylamino)propylamino]-6-(dimethylsulfamoylamino)pyridazine |
| SMILES | CN(C)CCCNc1ccc(NS(=O)(=O)N(C)C)nn1 |
| InChI | InChI=1S/C11H22N6O2S/c1-16(2)9-5-8-12-10-6-7-11(14-13-10)15-20(18,19)17(3)4/h6-7H,5,8-9H2,1-4H3,(H,12,13)(H,14,15) |
| InChIKey | UOHFVFJNNOPCNC-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|