C17H25N5O3S — CID 113040198
N-[6-[3-(dimethylamino)propylamino]pyridazin-3-yl]-4-ethoxybenzenesulfonamide (PubChem CID 113040198) has the molecular formula C17H25N5O3S and a molecular weight of 379.49 g/mol. Its IUPAC name is N-[6-[3-(dimethylamino)propylamino]pyridazin-3-yl]-4-ethoxybenzenesulfonamide.
| Compound Name | N-[6-[3-(dimethylamino)propylamino]pyridazin-3-yl]-4-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 113040198 |
| Molecular Formula | C17H25N5O3S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N-[6-[3-(dimethylamino)propylamino]pyridazin-3-yl]-4-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(NCCCN(C)C)nn2)cc1 |
| InChI | InChI=1S/C17H25N5O3S/c1-4-25-14-6-8-15(9-7-14)26(23,24)21-17-11-10-16(19-20-17)18-12-5-13-22(2)3/h6-11H,4-5,12-13H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | OKDHWILUOWXNJR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|