C14H19N5O3S — CID 113041805
3-(dimethylsulfamoylamino)-6-[(4-methoxyphenyl)methylamino]pyridazine (PubChem CID 113041805) has the molecular formula C14H19N5O3S and a molecular weight of 337.41 g/mol. Its IUPAC name is 3-(dimethylsulfamoylamino)-6-[(4-methoxyphenyl)methylamino]pyridazine.
| Compound Name | 3-(dimethylsulfamoylamino)-6-[(4-methoxyphenyl)methylamino]pyridazine |
|---|---|
| PubChem CID | 113041805 |
| Molecular Formula | C14H19N5O3S |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 3-(dimethylsulfamoylamino)-6-[(4-methoxyphenyl)methylamino]pyridazine |
| SMILES | COc1ccc(CNc2ccc(NS(=O)(=O)N(C)C)nn2)cc1 |
| InChI | InChI=1S/C14H19N5O3S/c1-19(2)23(20,21)18-14-9-8-13(16-17-14)15-10-11-4-6-12(22-3)7-5-11/h4-9H,10H2,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | SDOUALINADCUKF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |