C14H19N5O2S — CID 113041130
3-(dimethylsulfamoylamino)-6-[(4-methylphenyl)methylamino]pyridazine (PubChem CID 113041130) has the molecular formula C14H19N5O2S and a molecular weight of 321.41 g/mol. Its IUPAC name is 3-(dimethylsulfamoylamino)-6-[(4-methylphenyl)methylamino]pyridazine.
| Compound Name | 3-(dimethylsulfamoylamino)-6-[(4-methylphenyl)methylamino]pyridazine |
|---|---|
| PubChem CID | 113041130 |
| Molecular Formula | C14H19N5O2S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 3-(dimethylsulfamoylamino)-6-[(4-methylphenyl)methylamino]pyridazine |
| SMILES | Cc1ccc(CNc2ccc(NS(=O)(=O)N(C)C)nn2)cc1 |
| InChI | InChI=1S/C14H19N5O2S/c1-11-4-6-12(7-5-11)10-15-13-8-9-14(17-16-13)18-22(20,21)19(2)3/h4-9H,10H2,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | RXTAHAJOKCLDFT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |