C18H22ClN3O2S — CID 113030186
2-chloro-N-[5-(cycloheptylamino)-2-pyridinyl]benzenesulfonamide (PubChem CID 113030186) has the molecular formula C18H22ClN3O2S and a molecular weight of 379.91 g/mol. Its IUPAC name is 2-chloro-N-[5-(cycloheptylamino)-2-pyridinyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[5-(cycloheptylamino)-2-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113030186 |
| Molecular Formula | C18H22ClN3O2S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 2-chloro-N-[5-(cycloheptylamino)-2-pyridinyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(NC2CCCCCC2)cn1)c1ccccc1Cl |
| InChI | InChI=1S/C18H22ClN3O2S/c19-16-9-5-6-10-17(16)25(23,24)22-18-12-11-15(13-20-18)21-14-7-3-1-2-4-8-14/h5-6,9-14,21H,1-4,7-8H2,(H,20,22) |
| InChIKey | CQWZDTPQQCNMNH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |