C18H25N3O3S — CID 113024078
N-[5-(butylamino)-2-pyridinyl]-4-propan-2-yloxybenzenesulfonamide (PubChem CID 113024078) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is N-[5-(butylamino)-2-pyridinyl]-4-propan-2-yloxybenzenesulfonamide.
| Compound Name | N-[5-(butylamino)-2-pyridinyl]-4-propan-2-yloxybenzenesulfonamide |
|---|---|
| PubChem CID | 113024078 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-[5-(butylamino)-2-pyridinyl]-4-propan-2-yloxybenzenesulfonamide |
| SMILES | CCCCNc1ccc(NS(=O)(=O)c2ccc(OC(C)C)cc2)nc1 |
| InChI | InChI=1S/C18H25N3O3S/c1-4-5-12-19-15-6-11-18(20-13-15)21-25(22,23)17-9-7-16(8-10-17)24-14(2)3/h6-11,13-14,19H,4-5,12H2,1-3H3,(H,20,21) |
| InChIKey | NMZHRGLARDIDQP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|