C16H21FN4O2S — CID 113042623
N-[6-[2-(4-fluorophenyl)ethylamino]pyridazin-3-yl]butane-1-sulfonamide (PubChem CID 113042623) has the molecular formula C16H21FN4O2S and a molecular weight of 352.44 g/mol. Its IUPAC name is N-[6-[2-(4-fluorophenyl)ethylamino]pyridazin-3-yl]butane-1-sulfonamide.
| Compound Name | N-[6-[2-(4-fluorophenyl)ethylamino]pyridazin-3-yl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 113042623 |
| Molecular Formula | C16H21FN4O2S |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-[6-[2-(4-fluorophenyl)ethylamino]pyridazin-3-yl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1ccc(NCCc2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C16H21FN4O2S/c1-2-3-12-24(22,23)21-16-9-8-15(19-20-16)18-11-10-13-4-6-14(17)7-5-13/h4-9H,2-3,10-12H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | OFCYJDKMXAUWIE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |