C16H22N4O4S2 — CID 113028955
4-[2-[[6-(propylsulfonylamino)-3-pyridinyl]amino]ethyl]benzenesulfonamide (PubChem CID 113028955) has the molecular formula C16H22N4O4S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 4-[2-[[6-(propylsulfonylamino)-3-pyridinyl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[6-(propylsulfonylamino)-3-pyridinyl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113028955 |
| Molecular Formula | C16H22N4O4S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 4-[2-[[6-(propylsulfonylamino)-3-pyridinyl]amino]ethyl]benzenesulfonamide |
| SMILES | CCCS(=O)(=O)Nc1ccc(NCCc2ccc(S(N)(=O)=O)cc2)cn1 |
| InChI | InChI=1S/C16H22N4O4S2/c1-2-11-25(21,22)20-16-8-5-14(12-19-16)18-10-9-13-3-6-15(7-4-13)26(17,23)24/h3-8,12,18H,2,9-11H2,1H3,(H,19,20)(H2,17,23,24) |
| InChIKey | LCFSVGHJUVOGAQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |