C13H13F3N4O2S — CID 122157256
4-[2-[[6-(trifluoromethyl)pyridazin-3-yl]amino]ethyl]benzenesulfonamide (PubChem CID 122157256) has the molecular formula C13H13F3N4O2S and a molecular weight of 346.33 g/mol. Its IUPAC name is 4-[2-[[6-(trifluoromethyl)pyridazin-3-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[6-(trifluoromethyl)pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122157256 |
| Molecular Formula | C13H13F3N4O2S |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 4-[2-[[6-(trifluoromethyl)pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCNc2ccc(C(F)(F)F)nn2)cc1 |
| InChI | InChI=1S/C13H13F3N4O2S/c14-13(15,16)11-5-6-12(20-19-11)18-8-7-9-1-3-10(4-2-9)23(17,21)22/h1-6H,7-8H2,(H,18,20)(H2,17,21,22) |
| InChIKey | PSWMTGKSDMISBM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |