C17H23N3O4S — CID 113029927
N-[5-[2-(4-methoxyphenoxy)ethylamino]-2-pyridinyl]propane-1-sulfonamide (PubChem CID 113029927) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is N-[5-[2-(4-methoxyphenoxy)ethylamino]-2-pyridinyl]propane-1-sulfonamide.
| Compound Name | N-[5-[2-(4-methoxyphenoxy)ethylamino]-2-pyridinyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 113029927 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-[5-[2-(4-methoxyphenoxy)ethylamino]-2-pyridinyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1ccc(NCCOc2ccc(OC)cc2)cn1 |
| InChI | InChI=1S/C17H23N3O4S/c1-3-12-25(21,22)20-17-9-4-14(13-19-17)18-10-11-24-16-7-5-15(23-2)6-8-16/h4-9,13,18H,3,10-12H2,1-2H3,(H,19,20) |
| InChIKey | XMTFQPZEUFCIBX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|