C18H24N4O3 — CID 82034205
4-amino-N-[5-[2-(4-methoxyphenoxy)ethylamino]-2-pyridinyl]butanamide (PubChem CID 82034205) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 4-amino-N-[5-[2-(4-methoxyphenoxy)ethylamino]-2-pyridinyl]butanamide.
| Compound Name | 4-amino-N-[5-[2-(4-methoxyphenoxy)ethylamino]-2-pyridinyl]butanamide |
|---|---|
| PubChem CID | 82034205 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 4-amino-N-[5-[2-(4-methoxyphenoxy)ethylamino]-2-pyridinyl]butanamide |
| SMILES | COc1ccc(OCCNc2ccc(NC(=O)CCCN)nc2)cc1 |
| InChI | InChI=1S/C18H24N4O3/c1-24-15-5-7-16(8-6-15)25-12-11-20-14-4-9-17(21-13-14)22-18(23)3-2-10-19/h4-9,13,20H,2-3,10-12,19H2,1H3,(H,21,22,23) |
| InChIKey | HFPVHLGYUXFSGY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|