C12H20N4O3 — CID 82034177
3-amino-N-[5-[2-(2-hydroxyethoxy)ethylamino]-2-pyridinyl]propanamide (PubChem CID 82034177) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is 3-amino-N-[5-[2-(2-hydroxyethoxy)ethylamino]-2-pyridinyl]propanamide.
| Compound Name | 3-amino-N-[5-[2-(2-hydroxyethoxy)ethylamino]-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 82034177 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 3-amino-N-[5-[2-(2-hydroxyethoxy)ethylamino]-2-pyridinyl]propanamide |
| SMILES | NCCC(=O)Nc1ccc(NCCOCCO)cn1 |
| InChI | InChI=1S/C12H20N4O3/c13-4-3-12(18)16-11-2-1-10(9-15-11)14-5-7-19-8-6-17/h1-2,9,14,17H,3-8,13H2,(H,15,16,18) |
| InChIKey | CFCJYEOLISGAJH-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|