C18H23N3O5 — CID 28901488
N-[6-[2-(2-hydroxyethoxy)ethylamino]-3-pyridinyl]-2,6-dimethoxybenzamide (PubChem CID 28901488) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is N-[6-[2-(2-hydroxyethoxy)ethylamino]-3-pyridinyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[6-[2-(2-hydroxyethoxy)ethylamino]-3-pyridinyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 28901488 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-[6-[2-(2-hydroxyethoxy)ethylamino]-3-pyridinyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1ccc(NCCOCCO)nc1 |
| InChI | InChI=1S/C18H23N3O5/c1-24-14-4-3-5-15(25-2)17(14)18(23)21-13-6-7-16(20-12-13)19-8-10-26-11-9-22/h3-7,12,22H,8-11H2,1-2H3,(H,19,20)(H,21,23) |
| InChIKey | RXSSDLWXVBNGIY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|