C19H25N3O4 — CID 28901568
2-(3-ethylphenoxy)-N-[6-[2-(2-hydroxyethoxy)ethylamino]-3-pyridinyl]acetamide (PubChem CID 28901568) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-(3-ethylphenoxy)-N-[6-[2-(2-hydroxyethoxy)ethylamino]-3-pyridinyl]acetamide.
| Compound Name | 2-(3-ethylphenoxy)-N-[6-[2-(2-hydroxyethoxy)ethylamino]-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 28901568 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 2-(3-ethylphenoxy)-N-[6-[2-(2-hydroxyethoxy)ethylamino]-3-pyridinyl]acetamide |
| SMILES | CCc1cccc(OCC(=O)Nc2ccc(NCCOCCO)nc2)c1 |
| InChI | InChI=1S/C19H25N3O4/c1-2-15-4-3-5-17(12-15)26-14-19(24)22-16-6-7-18(21-13-16)20-8-10-25-11-9-23/h3-7,12-13,23H,2,8-11,14H2,1H3,(H,20,21)(H,22,24) |
| InChIKey | PLOFOLJPOTXYTA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|