C15H19N3O3S — CID 28901499
N-[6-[2-(2-hydroxyethoxy)ethylamino]-3-pyridinyl]-2-thiophen-2-ylacetamide (PubChem CID 28901499) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is N-[6-[2-(2-hydroxyethoxy)ethylamino]-3-pyridinyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[6-[2-(2-hydroxyethoxy)ethylamino]-3-pyridinyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 28901499 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-[6-[2-(2-hydroxyethoxy)ethylamino]-3-pyridinyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1ccc(NCCOCCO)nc1 |
| InChI | InChI=1S/C15H19N3O3S/c19-6-8-21-7-5-16-14-4-3-12(11-17-14)18-15(20)10-13-2-1-9-22-13/h1-4,9,11,19H,5-8,10H2,(H,16,17)(H,18,20) |
| InChIKey | GKCDZSJXOFHAAY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|