C17H22N4O2S — CID 113010856
N-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]-2-thiophen-2-ylacetamide (PubChem CID 113010856) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is N-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 113010856 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1ccc(NCCN2CCOCC2)nc1 |
| InChI | InChI=1S/C17H22N4O2S/c22-17(12-15-2-1-11-24-15)20-14-3-4-16(19-13-14)18-5-6-21-7-9-23-10-8-21/h1-4,11,13H,5-10,12H2,(H,18,19)(H,20,22) |
| InChIKey | LJPDXEJMXJIAII-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |