C16H24N4O4 — CID 39178028
4-[[6-(3-morpholin-4-ylpropylamino)-3-pyridinyl]amino]-4-oxobutanoic acid (PubChem CID 39178028) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-[[6-(3-morpholin-4-ylpropylamino)-3-pyridinyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[6-(3-morpholin-4-ylpropylamino)-3-pyridinyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 39178028 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 4-[[6-(3-morpholin-4-ylpropylamino)-3-pyridinyl]amino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)Nc1ccc(NCCCN2CCOCC2)nc1 |
| InChI | InChI=1S/C16H24N4O4/c21-15(4-5-16(22)23)19-13-2-3-14(18-12-13)17-6-1-7-20-8-10-24-11-9-20/h2-3,12H,1,4-11H2,(H,17,18)(H,19,21)(H,22,23) |
| InChIKey | TXZDBKMLNKSYDG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|