C25H26N4O2 — CID 91346773
N-[6-(3-morpholin-4-ylpropylamino)-3-pyridinyl]acenaphthylene-1-carboxamide (PubChem CID 91346773) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-[6-(3-morpholin-4-ylpropylamino)-3-pyridinyl]acenaphthylene-1-carboxamide.
| Compound Name | N-[6-(3-morpholin-4-ylpropylamino)-3-pyridinyl]acenaphthylene-1-carboxamide |
|---|---|
| PubChem CID | 91346773 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | N-[6-(3-morpholin-4-ylpropylamino)-3-pyridinyl]acenaphthylene-1-carboxamide |
| SMILES | O=C(Nc1ccc(NCCCN2CCOCC2)nc1)C1=Cc2cccc3cccc1c23 |
| InChI | InChI=1S/C25H26N4O2/c30-25(22-16-19-6-1-4-18-5-2-7-21(22)24(18)19)28-20-8-9-23(27-17-20)26-10-3-11-29-12-14-31-15-13-29/h1-2,4-9,16-17H,3,10-15H2,(H,26,27)(H,28,30) |
| InChIKey | SADHCSUEMWGXGY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|