C13H20N4O3 — CID 113010883
methyl N-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]carbamate (PubChem CID 113010883) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is methyl N-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]carbamate.
| Compound Name | methyl N-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 113010883 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | methyl N-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]carbamate |
| SMILES | COC(=O)Nc1ccc(NCCN2CCOCC2)nc1 |
| InChI | InChI=1S/C13H20N4O3/c1-19-13(18)16-11-2-3-12(15-10-11)14-4-5-17-6-8-20-9-7-17/h2-3,10H,4-9H2,1H3,(H,14,15)(H,16,18) |
| InChIKey | RRZOSSYPIXEYPK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |