C15H26N4O3S — CID 113010893
N-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]butane-1-sulfonamide (PubChem CID 113010893) has the molecular formula C15H26N4O3S and a molecular weight of 342.47 g/mol. Its IUPAC name is N-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]butane-1-sulfonamide.
| Compound Name | N-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 113010893 |
| Molecular Formula | C15H26N4O3S |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1ccc(NCCN2CCOCC2)nc1 |
| InChI | InChI=1S/C15H26N4O3S/c1-2-3-12-23(20,21)18-14-4-5-15(17-13-14)16-6-7-19-8-10-22-11-9-19/h4-5,13,18H,2-3,6-12H2,1H3,(H,16,17) |
| InChIKey | VFMWMWOUKYXCTD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |