C17H22N4O3S — CID 113025678
N-[5-(2-morpholin-4-ylethylamino)-2-pyridinyl]benzenesulfonamide (PubChem CID 113025678) has the molecular formula C17H22N4O3S and a molecular weight of 362.45 g/mol. Its IUPAC name is N-[5-(2-morpholin-4-ylethylamino)-2-pyridinyl]benzenesulfonamide.
| Compound Name | N-[5-(2-morpholin-4-ylethylamino)-2-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113025678 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-[5-(2-morpholin-4-ylethylamino)-2-pyridinyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(NCCN2CCOCC2)cn1)c1ccccc1 |
| InChI | InChI=1S/C17H22N4O3S/c22-25(23,16-4-2-1-3-5-16)20-17-7-6-15(14-19-17)18-8-9-21-10-12-24-13-11-21/h1-7,14,18H,8-13H2,(H,19,20) |
| InChIKey | VSZYCXRUKKHVRP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |