C17H13Cl2N3O2S — CID 113036847
N-[5-(2,6-dichloroanilino)-2-pyridinyl]benzenesulfonamide (PubChem CID 113036847) has the molecular formula C17H13Cl2N3O2S and a molecular weight of 394.28 g/mol. Its IUPAC name is N-[5-(2,6-dichloroanilino)-2-pyridinyl]benzenesulfonamide.
| Compound Name | N-[5-(2,6-dichloroanilino)-2-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113036847 |
| Molecular Formula | C17H13Cl2N3O2S |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | N-[5-(2,6-dichloroanilino)-2-pyridinyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Nc2c(Cl)cccc2Cl)cn1)c1ccccc1 |
| InChI | InChI=1S/C17H13Cl2N3O2S/c18-14-7-4-8-15(19)17(14)21-12-9-10-16(20-11-12)22-25(23,24)13-5-2-1-3-6-13/h1-11,21H,(H,20,22) |
| InChIKey | RTSBUWMZAKTARF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |