C19H22N4O3 — CID 28901497
N-[6-[2-(2-hydroxyethoxy)ethylamino]-3-pyridinyl]-2-(1H-indol-3-yl)acetamide (PubChem CID 28901497) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[6-[2-(2-hydroxyethoxy)ethylamino]-3-pyridinyl]-2-(1H-indol-3-yl)acetamide.
| Compound Name | N-[6-[2-(2-hydroxyethoxy)ethylamino]-3-pyridinyl]-2-(1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 28901497 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-[6-[2-(2-hydroxyethoxy)ethylamino]-3-pyridinyl]-2-(1H-indol-3-yl)acetamide |
| SMILES | O=C(Cc1c[nH]c2ccccc12)Nc1ccc(NCCOCCO)nc1 |
| InChI | InChI=1S/C19H22N4O3/c24-8-10-26-9-7-20-18-6-5-15(13-22-18)23-19(25)11-14-12-21-17-4-2-1-3-16(14)17/h1-6,12-13,21,24H,7-11H2,(H,20,22)(H,23,25) |
| InChIKey | SYEICILKQQFFMR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|