C7H16N2O3 — CID 61274475
3-amino-N-[2-(2-hydroxyethoxy)ethyl]propanamide (PubChem CID 61274475) has the molecular formula C7H16N2O3 and a molecular weight of 176.22 g/mol. Its IUPAC name is 3-amino-N-[2-(2-hydroxyethoxy)ethyl]propanamide.
| Compound Name | 3-amino-N-[2-(2-hydroxyethoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 61274475 |
| Molecular Formula | C7H16N2O3 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 3-amino-N-[2-(2-hydroxyethoxy)ethyl]propanamide |
| SMILES | NCCC(=O)NCCOCCO |
| InChI | InChI=1S/C7H16N2O3/c8-2-1-7(11)9-3-5-12-6-4-10/h10H,1-6,8H2,(H,9,11) |
| InChIKey | GQYQBCNOJWXMAG-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|