C28H60N2O7 — CID 166636671
2-(2-aminoethoxy)ethanol;decanoic acid;N-[2-(2-hydroxyethoxy)ethyl]decanamide (PubChem CID 166636671) has the molecular formula C28H60N2O7 and a molecular weight of 536.80 g/mol. Its IUPAC name is 2-(2-aminoethoxy)ethanol;decanoic acid;N-[2-(2-hydroxyethoxy)ethyl]decanamide.
| Compound Name | 2-(2-aminoethoxy)ethanol;decanoic acid;N-[2-(2-hydroxyethoxy)ethyl]decanamide |
|---|---|
| PubChem CID | 166636671 |
| Molecular Formula | C28H60N2O7 |
| Molecular Weight | 536.80 g/mol |
| Exact Mass | 536.44 |
| IUPAC Name | 2-(2-aminoethoxy)ethanol;decanoic acid;N-[2-(2-hydroxyethoxy)ethyl]decanamide |
| SMILES | CCCCCCCCCC(=O)NCCOCCO.CCCCCCCCCC(=O)O.NCCOCCO |
| InChI | InChI=1S/C14H29NO3.C10H20O2.C4H11NO2/c1-2-3-4-5-6-7-8-9-14(17)15-10-12-18-13-11-16;1-2-3-4-5-6-7-8-9-10(11)12;5-1-3-7-4-2-6/h16H,2-13H2,1H3,(H,15,17);2-9H2,1H3,(H,11,12);6H,1-5H2 |
| InChIKey | MGXAWCIGJXHKNZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 151.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.80 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|