C16H20FN3 — CID 80785034
6-N-[2-(4-fluorophenyl)ethyl]-2-N-propylpyridine-2,6-diamine (PubChem CID 80785034) has the molecular formula C16H20FN3 and a molecular weight of 273.36 g/mol. Its IUPAC name is 6-N-[2-(4-fluorophenyl)ethyl]-2-N-propylpyridine-2,6-diamine.
| Compound Name | 6-N-[2-(4-fluorophenyl)ethyl]-2-N-propylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 80785034 |
| Molecular Formula | C16H20FN3 |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 6-N-[2-(4-fluorophenyl)ethyl]-2-N-propylpyridine-2,6-diamine |
| SMILES | CCCNc1cccc(NCCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C16H20FN3/c1-2-11-18-15-4-3-5-16(20-15)19-12-10-13-6-8-14(17)9-7-13/h3-9H,2,10-12H2,1H3,(H2,18,19,20) |
| InChIKey | RFCUZOLWEQIRHP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |