C17H23N3 — CID 106900926
6-N-[(4-ethylphenyl)methyl]-2-N-propylpyridine-2,6-diamine (PubChem CID 106900926) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is 6-N-[(4-ethylphenyl)methyl]-2-N-propylpyridine-2,6-diamine.
| Compound Name | 6-N-[(4-ethylphenyl)methyl]-2-N-propylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 106900926 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 6-N-[(4-ethylphenyl)methyl]-2-N-propylpyridine-2,6-diamine |
| SMILES | CCCNc1cccc(NCc2ccc(CC)cc2)n1 |
| InChI | InChI=1S/C17H23N3/c1-3-12-18-16-6-5-7-17(20-16)19-13-15-10-8-14(4-2)9-11-15/h5-11H,3-4,12-13H2,1-2H3,(H2,18,19,20) |
| InChIKey | QAHYBSRKMMGSNL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |