C13H23N3 — CID 80770551
6-N-pentan-3-yl-2-N-propylpyridine-2,6-diamine (PubChem CID 80770551) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is 6-N-pentan-3-yl-2-N-propylpyridine-2,6-diamine.
| Compound Name | 6-N-pentan-3-yl-2-N-propylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 80770551 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 6-N-pentan-3-yl-2-N-propylpyridine-2,6-diamine |
| SMILES | CCCNc1cccc(NC(CC)CC)n1 |
| InChI | InChI=1S/C13H23N3/c1-4-10-14-12-8-7-9-13(16-12)15-11(5-2)6-3/h7-9,11H,4-6,10H2,1-3H3,(H2,14,15,16) |
| InChIKey | HDLQESYTWCHFAO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |