C15H27N3 — CID 80803403
6-N-heptan-2-yl-2-N-propylpyridine-2,6-diamine (PubChem CID 80803403) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 6-N-heptan-2-yl-2-N-propylpyridine-2,6-diamine.
| Compound Name | 6-N-heptan-2-yl-2-N-propylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 80803403 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 6-N-heptan-2-yl-2-N-propylpyridine-2,6-diamine |
| SMILES | CCCCCC(C)Nc1cccc(NCCC)n1 |
| InChI | InChI=1S/C15H27N3/c1-4-6-7-9-13(3)17-15-11-8-10-14(18-15)16-12-5-2/h8,10-11,13H,4-7,9,12H2,1-3H3,(H2,16,17,18) |
| InChIKey | QEJSIIZQVQLKFA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|