C14H15ClFN3 — CID 107531766
6-N-(2-chloro-5-fluorophenyl)-2-N-propylpyridine-2,6-diamine (PubChem CID 107531766) has the molecular formula C14H15ClFN3 and a molecular weight of 279.75 g/mol. Its IUPAC name is 6-N-(2-chloro-5-fluorophenyl)-2-N-propylpyridine-2,6-diamine.
| Compound Name | 6-N-(2-chloro-5-fluorophenyl)-2-N-propylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 107531766 |
| Molecular Formula | C14H15ClFN3 |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 6-N-(2-chloro-5-fluorophenyl)-2-N-propylpyridine-2,6-diamine |
| SMILES | CCCNc1cccc(Nc2cc(F)ccc2Cl)n1 |
| InChI | InChI=1S/C14H15ClFN3/c1-2-8-17-13-4-3-5-14(19-13)18-12-9-10(16)6-7-11(12)15/h3-7,9H,2,8H2,1H3,(H2,17,18,19) |
| InChIKey | PLJITAGZZUBCJJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |