C13H13FIN3 — CID 80849440
2-N-ethyl-6-N-(4-fluoro-2-iodophenyl)pyridine-2,6-diamine (PubChem CID 80849440) has the molecular formula C13H13FIN3 and a molecular weight of 357.17 g/mol. Its IUPAC name is 2-N-ethyl-6-N-(4-fluoro-2-iodophenyl)pyridine-2,6-diamine.
| Compound Name | 2-N-ethyl-6-N-(4-fluoro-2-iodophenyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 80849440 |
| Molecular Formula | C13H13FIN3 |
| Molecular Weight | 357.17 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 2-N-ethyl-6-N-(4-fluoro-2-iodophenyl)pyridine-2,6-diamine |
| SMILES | CCNc1cccc(Nc2ccc(F)cc2I)n1 |
| InChI | InChI=1S/C13H13FIN3/c1-2-16-12-4-3-5-13(18-12)17-11-7-6-9(14)8-10(11)15/h3-8H,2H2,1H3,(H2,16,17,18) |
| InChIKey | KGZYZOGOQXUZKY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.17 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|