C14H16FIN4 — CID 80949746
4-N-(4-fluoro-2-iodophenyl)-6-N-methyl-2-propylpyrimidine-4,6-diamine (PubChem CID 80949746) has the molecular formula C14H16FIN4 and a molecular weight of 386.21 g/mol. Its IUPAC name is 4-N-(4-fluoro-2-iodophenyl)-6-N-methyl-2-propylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(4-fluoro-2-iodophenyl)-6-N-methyl-2-propylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80949746 |
| Molecular Formula | C14H16FIN4 |
| Molecular Weight | 386.21 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 4-N-(4-fluoro-2-iodophenyl)-6-N-methyl-2-propylpyrimidine-4,6-diamine |
| SMILES | CCCc1nc(NC)cc(Nc2ccc(F)cc2I)n1 |
| InChI | InChI=1S/C14H16FIN4/c1-3-4-12-19-13(17-2)8-14(20-12)18-11-6-5-9(15)7-10(11)16/h5-8H,3-4H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | GUESDUXPFKLZHC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.21 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|