C13H12F3N3 — CID 80824451
2-N-ethyl-6-N-(3,4,5-trifluorophenyl)pyridine-2,6-diamine (PubChem CID 80824451) has the molecular formula C13H12F3N3 and a molecular weight of 267.25 g/mol. Its IUPAC name is 2-N-ethyl-6-N-(3,4,5-trifluorophenyl)pyridine-2,6-diamine.
| Compound Name | 2-N-ethyl-6-N-(3,4,5-trifluorophenyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 80824451 |
| Molecular Formula | C13H12F3N3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-N-ethyl-6-N-(3,4,5-trifluorophenyl)pyridine-2,6-diamine |
| SMILES | CCNc1cccc(Nc2cc(F)c(F)c(F)c2)n1 |
| InChI | InChI=1S/C13H12F3N3/c1-2-17-11-4-3-5-12(19-11)18-8-6-9(14)13(16)10(15)7-8/h3-7H,2H2,1H3,(H2,17,18,19) |
| InChIKey | QHFPBZSCEUJKNX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|