C14H15F2N3 — CID 80798545
6-N-(2,3-difluorophenyl)-2-N-propylpyridine-2,6-diamine (PubChem CID 80798545) has the molecular formula C14H15F2N3 and a molecular weight of 263.29 g/mol. Its IUPAC name is 6-N-(2,3-difluorophenyl)-2-N-propylpyridine-2,6-diamine.
| Compound Name | 6-N-(2,3-difluorophenyl)-2-N-propylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 80798545 |
| Molecular Formula | C14H15F2N3 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 6-N-(2,3-difluorophenyl)-2-N-propylpyridine-2,6-diamine |
| SMILES | CCCNc1cccc(Nc2cccc(F)c2F)n1 |
| InChI | InChI=1S/C14H15F2N3/c1-2-9-17-12-7-4-8-13(19-12)18-11-6-3-5-10(15)14(11)16/h3-8H,2,9H2,1H3,(H2,17,18,19) |
| InChIKey | YLRWQGVNVIXMEI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |