C12H13F2N5 — CID 80797550
4-N-(2,3-difluorophenyl)-6-N-ethylpyrimidine-2,4,6-triamine (PubChem CID 80797550) has the molecular formula C12H13F2N5 and a molecular weight of 265.27 g/mol. Its IUPAC name is 4-N-(2,3-difluorophenyl)-6-N-ethylpyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(2,3-difluorophenyl)-6-N-ethylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 80797550 |
| Molecular Formula | C12H13F2N5 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 4-N-(2,3-difluorophenyl)-6-N-ethylpyrimidine-2,4,6-triamine |
| SMILES | CCNc1cc(Nc2cccc(F)c2F)nc(N)n1 |
| InChI | InChI=1S/C12H13F2N5/c1-2-16-9-6-10(19-12(15)18-9)17-8-5-3-4-7(13)11(8)14/h3-6H,2H2,1H3,(H4,15,16,17,18,19) |
| InChIKey | OKJFEYWDURZIQZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |