C15H20N4O3S — CID 113037875
4-methoxy-3-methyl-N-[6-(propylamino)pyridazin-3-yl]benzenesulfonamide (PubChem CID 113037875) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is 4-methoxy-3-methyl-N-[6-(propylamino)pyridazin-3-yl]benzenesulfonamide.
| Compound Name | 4-methoxy-3-methyl-N-[6-(propylamino)pyridazin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 113037875 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 4-methoxy-3-methyl-N-[6-(propylamino)pyridazin-3-yl]benzenesulfonamide |
| SMILES | CCCNc1ccc(NS(=O)(=O)c2ccc(OC)c(C)c2)nn1 |
| InChI | InChI=1S/C15H20N4O3S/c1-4-9-16-14-7-8-15(18-17-14)19-23(20,21)12-5-6-13(22-3)11(2)10-12/h5-8,10H,4,9H2,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | ICJWJIRKGKCZSO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |