C19H28N4O3S — CID 113025801
N-[5-[3-(dimethylamino)propylamino]-2-pyridinyl]-4-methoxy-2,5-dimethylbenzenesulfonamide (PubChem CID 113025801) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is N-[5-[3-(dimethylamino)propylamino]-2-pyridinyl]-4-methoxy-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[5-[3-(dimethylamino)propylamino]-2-pyridinyl]-4-methoxy-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 113025801 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | N-[5-[3-(dimethylamino)propylamino]-2-pyridinyl]-4-methoxy-2,5-dimethylbenzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)Nc2ccc(NCCCN(C)C)cn2)cc1C |
| InChI | InChI=1S/C19H28N4O3S/c1-14-12-18(15(2)11-17(14)26-5)27(24,25)22-19-8-7-16(13-21-19)20-9-6-10-23(3)4/h7-8,11-13,20H,6,9-10H2,1-5H3,(H,21,22) |
| InChIKey | XOZQFLLRBPGEPB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|