C15H19N3O3S — CID 113028442
N-[5-[2-(3-methoxyphenyl)ethylamino]-2-pyridinyl]methanesulfonamide (PubChem CID 113028442) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is N-[5-[2-(3-methoxyphenyl)ethylamino]-2-pyridinyl]methanesulfonamide.
| Compound Name | N-[5-[2-(3-methoxyphenyl)ethylamino]-2-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 113028442 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-[5-[2-(3-methoxyphenyl)ethylamino]-2-pyridinyl]methanesulfonamide |
| SMILES | COc1cccc(CCNc2ccc(NS(C)(=O)=O)nc2)c1 |
| InChI | InChI=1S/C15H19N3O3S/c1-21-14-5-3-4-12(10-14)8-9-16-13-6-7-15(17-11-13)18-22(2,19)20/h3-7,10-11,16H,8-9H2,1-2H3,(H,17,18) |
| InChIKey | IXOARCFDDHTFKX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |