C19H20N2O3S2 — CID 112983618
N-[4-[2-(3-methoxyphenyl)ethylamino]phenyl]thiophene-2-sulfonamide (PubChem CID 112983618) has the molecular formula C19H20N2O3S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-[4-[2-(3-methoxyphenyl)ethylamino]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[4-[2-(3-methoxyphenyl)ethylamino]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 112983618 |
| Molecular Formula | C19H20N2O3S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | N-[4-[2-(3-methoxyphenyl)ethylamino]phenyl]thiophene-2-sulfonamide |
| SMILES | COc1cccc(CCNc2ccc(NS(=O)(=O)c3cccs3)cc2)c1 |
| InChI | InChI=1S/C19H20N2O3S2/c1-24-18-5-2-4-15(14-18)11-12-20-16-7-9-17(10-8-16)21-26(22,23)19-6-3-13-25-19/h2-10,13-14,20-21H,11-12H2,1H3 |
| InChIKey | PXKXTPFRYKKCGY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |