C18H17NO3S2 — CID 27301138
N-(3-benzyl-4-methoxyphenyl)thiophene-2-sulfonamide (PubChem CID 27301138) has the molecular formula C18H17NO3S2 and a molecular weight of 359.47 g/mol. Its IUPAC name is N-(3-benzyl-4-methoxyphenyl)thiophene-2-sulfonamide.
| Compound Name | N-(3-benzyl-4-methoxyphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 27301138 |
| Molecular Formula | C18H17NO3S2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-(3-benzyl-4-methoxyphenyl)thiophene-2-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccs2)cc1Cc1ccccc1 |
| InChI | InChI=1S/C18H17NO3S2/c1-22-17-10-9-16(19-24(20,21)18-8-5-11-23-18)13-15(17)12-14-6-3-2-4-7-14/h2-11,13,19H,12H2,1H3 |
| InChIKey | LHPWEVVYFXXEDJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |