C19H20N2O4S — CID 27301181
N-(3-benzyl-4-methoxyphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 27301181) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is N-(3-benzyl-4-methoxyphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-(3-benzyl-4-methoxyphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 27301181 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | N-(3-benzyl-4-methoxyphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2c(C)noc2C)cc1Cc1ccccc1 |
| InChI | InChI=1S/C19H20N2O4S/c1-13-19(14(2)25-20-13)26(22,23)21-17-9-10-18(24-3)16(12-17)11-15-7-5-4-6-8-15/h4-10,12,21H,11H2,1-3H3 |
| InChIKey | VCFMDQXVVVNKJG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |