C12H12N2O4S — CID 106913000
N-(3-formylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 106913000) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is N-(3-formylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-(3-formylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 106913000 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | N-(3-formylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)Nc1cccc(C=O)c1 |
| InChI | InChI=1S/C12H12N2O4S/c1-8-12(9(2)18-13-8)19(16,17)14-11-5-3-4-10(6-11)7-15/h3-7,14H,1-2H3 |
| InChIKey | FAULNEQRZZMJFT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|