C14H17N3O4S — CID 9330058
3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]-N-ethylbenzamide (PubChem CID 9330058) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]-N-ethylbenzamide.
| Compound Name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 9330058 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(NS(=O)(=O)c2c(C)noc2C)c1 |
| InChI | InChI=1S/C14H17N3O4S/c1-4-15-14(18)11-6-5-7-12(8-11)17-22(19,20)13-9(2)16-21-10(13)3/h5-8,17H,4H2,1-3H3,(H,15,18) |
| InChIKey | MACJWCGUIZYVKB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |