C14H16ClN3O4S — CID 108571403
3-chloro-N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]ethyl]benzamide (PubChem CID 108571403) has the molecular formula C14H16ClN3O4S and a molecular weight of 357.82 g/mol. Its IUPAC name is 3-chloro-N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]ethyl]benzamide.
| Compound Name | 3-chloro-N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 108571403 |
| Molecular Formula | C14H16ClN3O4S |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 3-chloro-N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]ethyl]benzamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)NCCNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H16ClN3O4S/c1-9-13(10(2)22-18-9)23(20,21)17-7-6-16-14(19)11-4-3-5-12(15)8-11/h3-5,8,17H,6-7H2,1-2H3,(H,16,19) |
| InChIKey | OTFWCQPUTZNUOO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|